C18H22N2O3 — CID 4235851
propan-2-yl N-(furan-2-carbonyl)-N'-(3-phenylpropyl)carbamimidate (PubChem CID 4235851) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is propan-2-yl N-(furan-2-carbonyl)-N'-(3-phenylpropyl)carbamimidate.
| Compound Name | propan-2-yl N-(furan-2-carbonyl)-N'-(3-phenylpropyl)carbamimidate |
|---|---|
| PubChem CID | 4235851 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | propan-2-yl N-(furan-2-carbonyl)-N'-(3-phenylpropyl)carbamimidate |
| SMILES | CC(C)O/C(=N\CCCc1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H22N2O3/c1-14(2)23-18(20-17(21)16-11-7-13-22-16)19-12-6-10-15-8-4-3-5-9-15/h3-5,7-9,11,13-14H,6,10,12H2,1-2H3,(H,19,20,21) |
| InChIKey | ZBRBGEIKTUZVIM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|