C20H24N2O2 — CID 7414333
ethyl N-(2-methylbenzoyl)-N'-(3-phenylpropyl)carbamimidate (PubChem CID 7414333) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethyl N-(2-methylbenzoyl)-N'-(3-phenylpropyl)carbamimidate.
| Compound Name | ethyl N-(2-methylbenzoyl)-N'-(3-phenylpropyl)carbamimidate |
|---|---|
| PubChem CID | 7414333 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | ethyl N-(2-methylbenzoyl)-N'-(3-phenylpropyl)carbamimidate |
| SMILES | CCO/C(=N\CCCc1ccccc1)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C20H24N2O2/c1-3-24-20(21-15-9-13-17-11-5-4-6-12-17)22-19(23)18-14-8-7-10-16(18)2/h4-8,10-12,14H,3,9,13,15H2,1-2H3,(H,21,22,23) |
| InChIKey | DMJVDNFCMHUSJU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|