C23H30N2O5 — CID 7264739
2-ethoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methylbenzoyl)carbamimidate (PubChem CID 7264739) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-ethoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methylbenzoyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methylbenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7264739 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-ethoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methylbenzoyl)carbamimidate |
| SMILES | CCOCCO/C(=N\CCc1ccc(OC)c(OC)c1)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C23H30N2O5/c1-5-29-14-15-30-23(25-22(26)19-9-7-6-8-17(19)2)24-13-12-18-10-11-20(27-3)21(16-18)28-4/h6-11,16H,5,12-15H2,1-4H3,(H,24,25,26) |
| InChIKey | ZMMZQTNBUTVAIM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|