C22H28N2O5 — CID 3973914
2-methoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-methylbenzoyl)carbamimidate (PubChem CID 3973914) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-methoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-methylbenzoyl)carbamimidate.
| Compound Name | 2-methoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-methylbenzoyl)carbamimidate |
|---|---|
| PubChem CID | 3973914 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-methoxyethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-methylbenzoyl)carbamimidate |
| SMILES | COCCO/C(=N\CCc1ccc(OC)c(OC)c1)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H28N2O5/c1-16-6-5-7-18(14-16)21(25)24-22(29-13-12-26-2)23-11-10-17-8-9-19(27-3)20(15-17)28-4/h5-9,14-15H,10-13H2,1-4H3,(H,23,24,25) |
| InChIKey | YPPLOLRAAXJSFY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|