C23H28N2O4 — CID 108555406
N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3-methylbenzamide (PubChem CID 108555406) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3-methylbenzamide.
| Compound Name | N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 108555406 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3-methylbenzamide |
| SMILES | COc1ccc(CC(=O)N2CCC(NC(=O)c3cccc(C)c3)CC2)cc1OC |
| InChI | InChI=1S/C23H28N2O4/c1-16-5-4-6-18(13-16)23(27)24-19-9-11-25(12-10-19)22(26)15-17-7-8-20(28-2)21(14-17)29-3/h4-8,13-14,19H,9-12,15H2,1-3H3,(H,24,27) |
| InChIKey | NHUANXVETKOPSR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |