C22H26N2O7 — CID 108551562
N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide (PubChem CID 108551562) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108551562 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide |
| SMILES | COc1ccc(CC(=O)N2CCC(NC(=O)c3cc(O)c(O)c(O)c3)CC2)cc1OC |
| InChI | InChI=1S/C22H26N2O7/c1-30-18-4-3-13(9-19(18)31-2)10-20(27)24-7-5-15(6-8-24)23-22(29)14-11-16(25)21(28)17(26)12-14/h3-4,9,11-12,15,25-26,28H,5-8,10H2,1-2H3,(H,23,29) |
| InChIKey | NHSSFTNZTKSMMD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|