C22H26N2O6 — CID 108551512
N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide (PubChem CID 108551512) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108551512 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide |
| SMILES | CCOc1ccc(CC(=O)N2CCC(NC(=O)c3cc(O)c(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-2-30-17-5-3-14(4-6-17)11-20(27)24-9-7-16(8-10-24)23-22(29)15-12-18(25)21(28)19(26)13-15/h3-6,12-13,16,25-26,28H,2,7-11H2,1H3,(H,23,29) |
| InChIKey | URFMNLUWUMWTOO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|