C23H27FN2O4 — CID 108556268
2-(4-ethoxyphenoxy)-N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]acetamide (PubChem CID 108556268) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108556268 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)NC2CCN(C(=O)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H27FN2O4/c1-2-29-20-7-9-21(10-8-20)30-16-22(27)25-19-11-13-26(14-12-19)23(28)15-17-3-5-18(24)6-4-17/h3-10,19H,2,11-16H2,1H3,(H,25,27) |
| InChIKey | ONJJPOXBAQQWPU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |