C24H30N2O5 — CID 108557001
N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2-(4-methylphenoxy)acetamide (PubChem CID 108557001) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 108557001 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2-(4-methylphenoxy)acetamide |
| SMILES | CCOc1ccc(OCC(=O)N2CCC(NC(=O)COc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-3-29-20-8-10-22(11-9-20)31-17-24(28)26-14-12-19(13-15-26)25-23(27)16-30-21-6-4-18(2)5-7-21/h4-11,19H,3,12-17H2,1-2H3,(H,25,27) |
| InChIKey | ITOKOSDIFDGREM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |