C17H21F3N2O4 — CID 108548748
N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 108548748) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 108548748 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCOc1ccc(OCC(=O)N2CCC(NC(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C17H21F3N2O4/c1-2-25-13-3-5-14(6-4-13)26-11-15(23)22-9-7-12(8-10-22)21-16(24)17(18,19)20/h3-6,12H,2,7-11H2,1H3,(H,21,24) |
| InChIKey | XMGDGAGKTBUERH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |