C26H32N2O4 — CID 108552056
N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-4-(4-methylphenyl)-4-oxobutanamide (PubChem CID 108552056) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-4-(4-methylphenyl)-4-oxobutanamide.
| Compound Name | N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-4-(4-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108552056 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[1-[2-(4-ethoxyphenyl)acetyl]piperidin-4-yl]-4-(4-methylphenyl)-4-oxobutanamide |
| SMILES | CCOc1ccc(CC(=O)N2CCC(NC(=O)CCC(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H32N2O4/c1-3-32-23-10-6-20(7-11-23)18-26(31)28-16-14-22(15-17-28)27-25(30)13-12-24(29)21-8-4-19(2)5-9-21/h4-11,22H,3,12-18H2,1-2H3,(H,27,30) |
| InChIKey | GKXQKDQMPOKWIM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |