C19H26N2O3 — CID 108552078
4-(4-methylphenyl)-4-oxo-N-(1-propanoylpiperidin-4-yl)butanamide (PubChem CID 108552078) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-N-(1-propanoylpiperidin-4-yl)butanamide.
| Compound Name | 4-(4-methylphenyl)-4-oxo-N-(1-propanoylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 108552078 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-N-(1-propanoylpiperidin-4-yl)butanamide |
| SMILES | CCC(=O)N1CCC(NC(=O)CCC(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-3-19(24)21-12-10-16(11-13-21)20-18(23)9-8-17(22)15-6-4-14(2)5-7-15/h4-7,16H,3,8-13H2,1-2H3,(H,20,23) |
| InChIKey | FEQYBMJLTVTYQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |