C17H22N2O6 — CID 108551555
3,4,5-trihydroxy-N-[1-(4-oxopentanoyl)piperidin-4-yl]benzamide (PubChem CID 108551555) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[1-(4-oxopentanoyl)piperidin-4-yl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[1-(4-oxopentanoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108551555 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3,4,5-trihydroxy-N-[1-(4-oxopentanoyl)piperidin-4-yl]benzamide |
| SMILES | CC(=O)CCC(=O)N1CCC(NC(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C17H22N2O6/c1-10(20)2-3-15(23)19-6-4-12(5-7-19)18-17(25)11-8-13(21)16(24)14(22)9-11/h8-9,12,21-22,24H,2-7H2,1H3,(H,18,25) |
| InChIKey | CQXJYEMCSVLLRX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|