C14H20N2O4 — CID 7413412
ethyl N-(3-methoxybenzoyl)-N'-(2-methoxyethyl)carbamimidate (PubChem CID 7413412) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethyl N-(3-methoxybenzoyl)-N'-(2-methoxyethyl)carbamimidate.
| Compound Name | ethyl N-(3-methoxybenzoyl)-N'-(2-methoxyethyl)carbamimidate |
|---|---|
| PubChem CID | 7413412 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | ethyl N-(3-methoxybenzoyl)-N'-(2-methoxyethyl)carbamimidate |
| SMILES | CCO/C(=N\CCOC)NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-4-20-14(15-8-9-18-2)16-13(17)11-6-5-7-12(10-11)19-3/h5-7,10H,4,8-9H2,1-3H3,(H,15,16,17) |
| InChIKey | NSLLKZVSDMSCNY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|