C17H23F3N3O2+ — CID 7231300
ethyl N'-(2-pyrrolidin-1-ium-1-ylethyl)-N-[3-(trifluoromethyl)benzoyl]carbamimidate (PubChem CID 7231300) has the molecular formula C17H23F3N3O2+ and a molecular weight of 358.38 g/mol. Its IUPAC name is ethyl N'-(2-pyrrolidin-1-ium-1-ylethyl)-N-[3-(trifluoromethyl)benzoyl]carbamimidate.
| Compound Name | ethyl N'-(2-pyrrolidin-1-ium-1-ylethyl)-N-[3-(trifluoromethyl)benzoyl]carbamimidate |
|---|---|
| PubChem CID | 7231300 |
| Molecular Formula | C17H23F3N3O2+ |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | ethyl N'-(2-pyrrolidin-1-ium-1-ylethyl)-N-[3-(trifluoromethyl)benzoyl]carbamimidate |
| SMILES | CCO/C(=N\CC[NH+]1CCCC1)NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3N3O2/c1-2-25-16(21-8-11-23-9-3-4-10-23)22-15(24)13-6-5-7-14(12-13)17(18,19)20/h5-7,12H,2-4,8-11H2,1H3,(H,21,22,24)/p+1 |
| InChIKey | IFPWHYNHQQZKKZ-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|