C21H29ClF3NO — CID 110185389
1-[2-[cyclohexylidene-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperidin-1-ium chloride (PubChem CID 110185389) has the molecular formula C21H29ClF3NO and a molecular weight of 403.92 g/mol. Its IUPAC name is 1-[2-[cyclohexylidene-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperidin-1-ium chloride.
| Compound Name | 1-[2-[cyclohexylidene-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperidin-1-ium chloride |
|---|---|
| PubChem CID | 110185389 |
| Molecular Formula | C21H29ClF3NO |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[2-[cyclohexylidene-[3-(trifluoromethyl)phenyl]methoxy]ethyl]piperidin-1-ium chloride |
| SMILES | FC(F)(F)c1cccc(C(OCC[NH+]2CCCCC2)=C2CCCCC2)c1.[Cl-] |
| InChI | InChI=1S/C21H28F3NO.ClH/c22-21(23,24)19-11-7-10-18(16-19)20(17-8-3-1-4-9-17)26-15-14-25-12-5-2-6-13-25;/h7,10-11,16H,1-6,8-9,12-15H2;1H |
| InChIKey | ICBUJVDUJBTLIK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|