C21H27F3N2O+2 — CID 2231663
1-benzyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine-1,4-diium (PubChem CID 2231663) has the molecular formula C21H27F3N2O+2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-benzyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 2231663 |
| Molecular Formula | C21H27F3N2O+2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-benzyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]piperazine-1,4-diium |
| SMILES | FC(F)(F)c1cccc(OCCC[NH+]2CC[NH+](Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25F3N2O/c22-21(23,24)19-8-4-9-20(16-19)27-15-5-10-25-11-13-26(14-12-25)17-18-6-2-1-3-7-18/h1-4,6-9,16H,5,10-15,17H2/p+2 |
| InChIKey | LMWWEPAWBSJXMQ-UHFFFAOYSA-P |
| XLogP | 1.46 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|