C26H32N2O+2 — CID 7344717
1-[(3-phenoxyphenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium (PubChem CID 7344717) has the molecular formula C26H32N2O+2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[(3-phenoxyphenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium.
| Compound Name | 1-[(3-phenoxyphenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 7344717 |
| Molecular Formula | C26H32N2O+2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 1-[(3-phenoxyphenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium |
| SMILES | c1ccc(CCC[NH+]2CC[NH+](Cc3cccc(Oc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C26H30N2O/c1-3-9-23(10-4-1)12-8-16-27-17-19-28(20-18-27)22-24-11-7-15-26(21-24)29-25-13-5-2-6-14-25/h1-7,9-11,13-15,21H,8,12,16-20,22H2/p+2 |
| InChIKey | CSDWAWHUPSSWKC-UHFFFAOYSA-P |
| XLogP | 2.40 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |