C20H27ClN2+2 — CID 6988360
1-[(3-chlorophenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium (PubChem CID 6988360) has the molecular formula C20H27ClN2+2 and a molecular weight of 330.90 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 6988360 |
| Molecular Formula | C20H27ClN2+2 |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-(3-phenylpropyl)piperazine-1,4-diium |
| SMILES | Clc1cccc(C[NH+]2CC[NH+](CCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H25ClN2/c21-20-10-4-8-19(16-20)17-23-14-12-22(13-15-23)11-5-9-18-6-2-1-3-7-18/h1-4,6-8,10,16H,5,9,11-15,17H2/p+2 |
| InChIKey | SOPFZSFWVNVFTB-UHFFFAOYSA-P |
| XLogP | 1.26 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |