C18H32N3+3 — CID 7436888
1-benzyl-4-(2-piperidin-1-ium-1-ylethyl)piperazine-1,4-diium (PubChem CID 7436888) has the molecular formula C18H32N3+3 and a molecular weight of 290.47 g/mol. Its IUPAC name is 1-benzyl-4-(2-piperidin-1-ium-1-ylethyl)piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-(2-piperidin-1-ium-1-ylethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 7436888 |
| Molecular Formula | C18H32N3+3 |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 1-benzyl-4-(2-piperidin-1-ium-1-ylethyl)piperazine-1,4-diium |
| SMILES | c1ccc(C[NH+]2CC[NH+](CC[NH+]3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H29N3/c1-3-7-18(8-4-1)17-21-15-13-20(14-16-21)12-11-19-9-5-2-6-10-19/h1,3-4,7-8H,2,5-6,9-17H2/p+3 |
| InChIKey | VVLVGZJFLAWJJM-UHFFFAOYSA-Q |
| XLogP | -1.96 |
| TPSA | 13.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |