C16H26N2+2 — CID 7108959
1-benzyl-4-cyclopentylpiperazine-1,4-diium (PubChem CID 7108959) has the molecular formula C16H26N2+2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-benzyl-4-cyclopentylpiperazine-1,4-diium.
| Compound Name | 1-benzyl-4-cyclopentylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7108959 |
| Molecular Formula | C16H26N2+2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-benzyl-4-cyclopentylpiperazine-1,4-diium |
| SMILES | c1ccc(C[NH+]2CC[NH+](C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C16H24N2/c1-2-6-15(7-3-1)14-17-10-12-18(13-11-17)16-8-4-5-9-16/h1-3,6-7,16H,4-5,8-14H2/p+2 |
| InChIKey | IMSFJZTXXYGAIE-UHFFFAOYSA-P |
| XLogP | -0.09 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |