C17H28N2+2 — CID 6937897
1-benzyl-4-[(1R,3R)-3-methylcyclopentyl]piperazine-1,4-diium (PubChem CID 6937897) has the molecular formula C17H28N2+2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-benzyl-4-[(1R,3R)-3-methylcyclopentyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[(1R,3R)-3-methylcyclopentyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6937897 |
| Molecular Formula | C17H28N2+2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 1-benzyl-4-[(1R,3R)-3-methylcyclopentyl]piperazine-1,4-diium |
| SMILES | C[C@@H]1CC[C@@H]([NH+]2CC[NH+](Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C17H26N2/c1-15-7-8-17(13-15)19-11-9-18(10-12-19)14-16-5-3-2-4-6-16/h2-6,15,17H,7-14H2,1H3/p+2/t15-,17-/m1/s1 |
| InChIKey | NCKWDNWFEUMYFJ-NVXWUHKLSA-P |
| XLogP | 0.16 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |