C13H20N+ — CID 7170878
(3R)-1-benzyl-3-methylpiperidin-1-ium (PubChem CID 7170878) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is (3R)-1-benzyl-3-methylpiperidin-1-ium.
| Compound Name | (3R)-1-benzyl-3-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 7170878 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | (3R)-1-benzyl-3-methylpiperidin-1-ium |
| SMILES | C[C@@H]1CCC[NH+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H19N/c1-12-6-5-9-14(10-12)11-13-7-3-2-4-8-13/h2-4,7-8,12H,5-6,9-11H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | VUEWBPBFUKIDKK-GFCCVEGCSA-O |
| XLogP | 1.50 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |