C19H32N2+2 — CID 7446009
(1-benzylpiperidin-1-ium-4-yl)-[(1R,3R)-3-methylcyclohexyl]azanium (PubChem CID 7446009) has the molecular formula C19H32N2+2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (1-benzylpiperidin-1-ium-4-yl)-[(1R,3R)-3-methylcyclohexyl]azanium.
| Compound Name | (1-benzylpiperidin-1-ium-4-yl)-[(1R,3R)-3-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 7446009 |
| Molecular Formula | C19H32N2+2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | (1-benzylpiperidin-1-ium-4-yl)-[(1R,3R)-3-methylcyclohexyl]azanium |
| SMILES | C[C@@H]1CCC[C@@H]([NH2+]C2CC[NH+](Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C19H30N2/c1-16-6-5-9-19(14-16)20-18-10-12-21(13-11-18)15-17-7-3-2-4-8-17/h2-4,7-8,16,18-20H,5-6,9-15H2,1H3/p+2/t16-,19-/m1/s1 |
| InChIKey | DDTFZLQLMMIXHG-VQIMIIECSA-P |
| XLogP | 1.38 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |