C23H33N3+2 — CID 7778195
(1-benzylpiperidin-1-ium-4-yl)-[(2-pyrrolidin-1-ylphenyl)methyl]azanium (PubChem CID 7778195) has the molecular formula C23H33N3+2 and a molecular weight of 351.54 g/mol. Its IUPAC name is (1-benzylpiperidin-1-ium-4-yl)-[(2-pyrrolidin-1-ylphenyl)methyl]azanium.
| Compound Name | (1-benzylpiperidin-1-ium-4-yl)-[(2-pyrrolidin-1-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7778195 |
| Molecular Formula | C23H33N3+2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | (1-benzylpiperidin-1-ium-4-yl)-[(2-pyrrolidin-1-ylphenyl)methyl]azanium |
| SMILES | c1ccc(C[NH+]2CCC([NH2+]Cc3ccccc3N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3/c1-2-8-20(9-3-1)19-25-16-12-22(13-17-25)24-18-21-10-4-5-11-23(21)26-14-6-7-15-26/h1-5,8-11,22,24H,6-7,12-19H2/p+2 |
| InChIKey | AIGZPVSOPWVZAN-UHFFFAOYSA-P |
| XLogP | 1.60 |
| TPSA | 24.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |