C22H38N2+2 — CID 7999489
(1-benzylpiperidin-1-ium-4-yl)-[(3S)-3,7-dimethyloct-6-enyl]azanium (PubChem CID 7999489) has the molecular formula C22H38N2+2 and a molecular weight of 330.56 g/mol. Its IUPAC name is (1-benzylpiperidin-1-ium-4-yl)-[(3S)-3,7-dimethyloct-6-enyl]azanium.
| Compound Name | (1-benzylpiperidin-1-ium-4-yl)-[(3S)-3,7-dimethyloct-6-enyl]azanium |
|---|---|
| PubChem CID | 7999489 |
| Molecular Formula | C22H38N2+2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | (1-benzylpiperidin-1-ium-4-yl)-[(3S)-3,7-dimethyloct-6-enyl]azanium |
| SMILES | CC(C)=CCC[C@H](C)CC[NH2+]C1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H36N2/c1-19(2)8-7-9-20(3)12-15-23-22-13-16-24(17-14-22)18-21-10-5-4-6-11-21/h4-6,8,10-11,20,22-23H,7,9,12-18H2,1-3H3/p+2/t20-/m0/s1 |
| InChIKey | FYIKXLUYUAQQLO-FQEVSTJZSA-P |
| XLogP | 2.57 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|