C14H28NO+ — CID 6943186
1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-1-ium-4-ol (PubChem CID 6943186) has the molecular formula C14H28NO+ and a molecular weight of 226.38 g/mol. Its IUPAC name is 1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-1-ium-4-ol.
| Compound Name | 1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6943186 |
| Molecular Formula | C14H28NO+ |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-1-ium-4-ol |
| SMILES | CC(C)=CCC[C@H](C)C[NH+]1CCC(O)CC1 |
| InChI | InChI=1S/C14H27NO/c1-12(2)5-4-6-13(3)11-15-9-7-14(16)8-10-15/h5,13-14,16H,4,6-11H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | BTYHNTIOIKYUEK-ZDUSSCGKSA-O |
| XLogP | 1.41 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|