C20H38Br2 — CID 131736485
(6S)-8-bromo-2,6-dimethyloct-2-ene;8-bromo-2,6-dimethyloct-2-ene (PubChem CID 131736485) has the molecular formula C20H38Br2 and a molecular weight of 438.33 g/mol. Its IUPAC name is (6S)-8-bromo-2,6-dimethyloct-2-ene;8-bromo-2,6-dimethyloct-2-ene.
| Compound Name | (6S)-8-bromo-2,6-dimethyloct-2-ene;8-bromo-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 131736485 |
| Molecular Formula | C20H38Br2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (6S)-8-bromo-2,6-dimethyloct-2-ene;8-bromo-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCBr.CC(C)=CCC[C@H](C)CCBr |
| InChI | InChI=1S/2C10H19Br/c2*1-9(2)5-4-6-10(3)7-8-11/h2*5,10H,4,6-8H2,1-3H3/t10-;/m0./s1 |
| InChIKey | CDPZKOICLWVLEL-PPHPATTJSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|