C30H44N2O10 — CID 110182188
(1-benzylpiperidin-1-ium-4-yl)-[3-(cyclohexylmethoxy)-2-hydroxypropyl]azanium;bis((E)-4-hydroxy-4-oxobut-2-enoate) (PubChem CID 110182188) has the molecular formula C30H44N2O10 and a molecular weight of 592.69 g/mol. Its IUPAC name is (1-benzylpiperidin-1-ium-4-yl)-[3-(cyclohexylmethoxy)-2-hydroxypropyl]azanium;bis((E)-4-hydroxy-4-oxobut-2-enoate).
| Compound Name | (1-benzylpiperidin-1-ium-4-yl)-[3-(cyclohexylmethoxy)-2-hydroxypropyl]azanium;bis((E)-4-hydroxy-4-oxobut-2-enoate) |
|---|---|
| PubChem CID | 110182188 |
| Molecular Formula | C30H44N2O10 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | (1-benzylpiperidin-1-ium-4-yl)-[3-(cyclohexylmethoxy)-2-hydroxypropyl]azanium;bis((E)-4-hydroxy-4-oxobut-2-enoate) |
| SMILES | O=C([O-])/C=C/C(=O)O.O=C([O-])/C=C/C(=O)O.OC(C[NH2+]C1CC[NH+](Cc2ccccc2)CC1)COCC1CCCCC1 |
| InChI | InChI=1S/C22H36N2O2.2C4H4O4/c25-22(18-26-17-20-9-5-2-6-10-20)15-23-21-11-13-24(14-12-21)16-19-7-3-1-4-8-19;2*5-3(6)1-2-4(7)8/h1,3-4,7-8,20-23,25H,2,5-6,9-18H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | LIJJROVCHNKRDI-LVEZLNDCSA-N |
| XLogP | -2.49 |
| TPSA | 205.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|