C18H32N2O+2 — CID 7100266
(1-benzylpiperidin-1-ium-4-yl)-[(2R)-2-hydroxyhexyl]azanium (PubChem CID 7100266) has the molecular formula C18H32N2O+2 and a molecular weight of 292.47 g/mol. Its IUPAC name is (1-benzylpiperidin-1-ium-4-yl)-[(2R)-2-hydroxyhexyl]azanium.
| Compound Name | (1-benzylpiperidin-1-ium-4-yl)-[(2R)-2-hydroxyhexyl]azanium |
|---|---|
| PubChem CID | 7100266 |
| Molecular Formula | C18H32N2O+2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | (1-benzylpiperidin-1-ium-4-yl)-[(2R)-2-hydroxyhexyl]azanium |
| SMILES | CCCC[C@@H](O)C[NH2+]C1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H30N2O/c1-2-3-9-18(21)14-19-17-10-12-20(13-11-17)15-16-7-5-4-6-8-16/h4-8,17-19,21H,2-3,9-15H2,1H3/p+2/t18-/m1/s1 |
| InChIKey | RWHFAMLHBCFRGK-GOSISDBHSA-P |
| XLogP | 0.35 |
| TPSA | 41.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |