About dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride
dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride (PubChem CID 11142400) has the molecular formula C17H24ClNO4
and a molecular weight of 341.83 g/mol. Its IUPAC name is dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride.
Molecular Properties
| Compound Name | dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride |
| PubChem CID | 11142400 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride |
| SMILES | COC(=O)C(C(=O)OC)C1CC[NH+](Cc2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C17H23NO4.ClH/c1-21-16(19)15(17(20)22-2)14-8-10-18(11-9-14)12-13-6-4-3-5-7-13;/h3-7,14-15H,8-12H2,1-2H3;1H |
| InChIKey | PPVWPLXENUZYHT-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride?
The IUPAC name of dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride (CID 11142400) is dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride.
What is the SMILES notation for dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride?
The canonical SMILES for dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride is COC(=O)C(C(=O)OC)C1CC[NH+](Cc2ccccc2)CC1.[Cl-].
What is the InChIKey of dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride?
The InChIKey is PPVWPLXENUZYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4.ClH/c1-21-16(19)15(17(20)22-2)14-8-10-18(11-9-14)12-13-6-4-3-5-7-13;/h3-7,14-15H,8-12H2,1-2H3;1H.
What are the key properties of dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride?
dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride has a molecular weight of 341.83 g/mol, XLogP of -2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(1-benzylpiperidin-1-ium-4-yl)propanedioate chloride is sourced from PubChem (CID 11142400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).