C14H22Cl2N2O2 — CID 44661832
3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride (PubChem CID 44661832) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride.
| Compound Name | 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride |
|---|---|
| PubChem CID | 44661832 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride |
| SMILES | O=C(O)CC[NH+]1CC[NH+](Cc2ccccc2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C14H20N2O2.2ClH/c17-14(18)6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13;;/h1-5H,6-12H2,(H,17,18);2*1H |
| InChIKey | IREPQAIEIMWDQH-UHFFFAOYSA-N |
| XLogP | -7.55 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | -7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |