3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride

C14H22Cl2N2O2 — CID 44661832

IUPAC3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride
SMILESO=C(O)CC[NH+]1CC[NH+](Cc2ccccc2)CC1.[Cl-].[Cl-]
InChIInChI=1S/C14H20N2O2.2ClH/c17-14(18)6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13;;/h1-5H,6-12H2,(H,17,18);2*1H
InChIKeyIREPQAIEIMWDQH-UHFFFAOYSA-N
MW321.25 g/mol
LogP-7.55
Rot. Bonds5

About 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride

3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride (PubChem CID 44661832) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride.

Molecular Properties

Compound Name3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride
PubChem CID44661832
Molecular FormulaC14H22Cl2N2O2
Molecular Weight321.25 g/mol
Exact Mass320.11
IUPAC Name3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride
SMILESO=C(O)CC[NH+]1CC[NH+](Cc2ccccc2)CC1.[Cl-].[Cl-]
InChIInChI=1S/C14H20N2O2.2ClH/c17-14(18)6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13;;/h1-5H,6-12H2,(H,17,18);2*1H
InChIKeyIREPQAIEIMWDQH-UHFFFAOYSA-N
XLogP-7.55
TPSA46.18 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.25
LogP ≤ 5-7.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride?
The IUPAC name of 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride (CID 44661832) is 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride.
What is the SMILES notation for 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride?
The canonical SMILES for 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride is O=C(O)CC[NH+]1CC[NH+](Cc2ccccc2)CC1.[Cl-].[Cl-].
What is the InChIKey of 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride?
The InChIKey is IREPQAIEIMWDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2.2ClH/c17-14(18)6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13;;/h1-5H,6-12H2,(H,17,18);2*1H.
What are the key properties of 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride?
3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride has a molecular weight of 321.25 g/mol, XLogP of -7.55, 5 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-benzylpiperazine-1,4-diium-1-yl)propanoic acid dichloride is sourced from PubChem (CID 44661832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).