C14H18F3NO2 — CID 87362972
1-benzylpiperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 87362972) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-benzylpiperidin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-benzylpiperidin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87362972 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-benzylpiperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1ccc(C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C12H17N.C2HF3O2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;3-2(4,5)1(6)7/h1,3-4,7-8H,2,5-6,9-11H2;(H,6,7) |
| InChIKey | VXQDWFKPUQMQHD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |