C19H23N2O2+ — CID 7282847
1,3-dibenzyl-1,3-diazinane-1,3-diium-2-carboxylate (PubChem CID 7282847) has the molecular formula C19H23N2O2+ and a molecular weight of 311.41 g/mol. Its IUPAC name is 1,3-dibenzyl-1,3-diazinane-1,3-diium-2-carboxylate.
| Compound Name | 1,3-dibenzyl-1,3-diazinane-1,3-diium-2-carboxylate |
|---|---|
| PubChem CID | 7282847 |
| Molecular Formula | C19H23N2O2+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1,3-dibenzyl-1,3-diazinane-1,3-diium-2-carboxylate |
| SMILES | O=C([O-])C1[NH+](Cc2ccccc2)CCC[NH+]1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c22-19(23)18-20(14-16-8-3-1-4-9-16)12-7-13-21(18)15-17-10-5-2-6-11-17/h1-6,8-11,18H,7,12-15H2,(H,22,23)/p+1 |
| InChIKey | KKOFJYVKROYBAN-UHFFFAOYSA-O |
| XLogP | -1.36 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |