C24H27N3O2+2 — CID 7290062
1,3-dibenzyl-2-(3-nitrophenyl)-1,3-diazinane-1,3-diium (PubChem CID 7290062) has the molecular formula C24H27N3O2+2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1,3-dibenzyl-2-(3-nitrophenyl)-1,3-diazinane-1,3-diium.
| Compound Name | 1,3-dibenzyl-2-(3-nitrophenyl)-1,3-diazinane-1,3-diium |
|---|---|
| PubChem CID | 7290062 |
| Molecular Formula | C24H27N3O2+2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1,3-dibenzyl-2-(3-nitrophenyl)-1,3-diazinane-1,3-diium |
| SMILES | O=[N+]([O-])c1cccc(C2[NH+](Cc3ccccc3)CCC[NH+]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H25N3O2/c28-27(29)23-14-7-13-22(17-23)24-25(18-20-9-3-1-4-10-20)15-8-16-26(24)19-21-11-5-2-6-12-21/h1-7,9-14,17,24H,8,15-16,18-19H2/p+2 |
| InChIKey | SMDKXZCYBNATBE-UHFFFAOYSA-P |
| XLogP | 2.17 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|