C18H22BrN3O2+2 — CID 4755192
1-[(4-bromophenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium (PubChem CID 4755192) has the molecular formula C18H22BrN3O2+2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 4755192 |
| Molecular Formula | C18H22BrN3O2+2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-[(3-nitrophenyl)methyl]piperazine-1,4-diium |
| SMILES | O=[N+]([O-])c1cccc(C[NH+]2CC[NH+](Cc3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C18H20BrN3O2/c19-17-6-4-15(5-7-17)13-20-8-10-21(11-9-20)14-16-2-1-3-18(12-16)22(23)24/h1-7,12H,8-11,13-14H2/p+2 |
| InChIKey | CTDJLEOOTDIFMP-UHFFFAOYSA-P |
| XLogP | 0.84 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|