C19H12Br2N2O2 — CID 134281193
2,7-dibromo-9-[(3-nitrophenyl)methyl]carbazole (PubChem CID 134281193) has the molecular formula C19H12Br2N2O2 and a molecular weight of 460.13 g/mol. Its IUPAC name is 2,7-dibromo-9-[(3-nitrophenyl)methyl]carbazole.
| Compound Name | 2,7-dibromo-9-[(3-nitrophenyl)methyl]carbazole |
|---|---|
| PubChem CID | 134281193 |
| Molecular Formula | C19H12Br2N2O2 |
| Molecular Weight | 460.13 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | 2,7-dibromo-9-[(3-nitrophenyl)methyl]carbazole |
| SMILES | O=[N+]([O-])c1cccc(Cn2c3cc(Br)ccc3c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C19H12Br2N2O2/c20-13-4-6-16-17-7-5-14(21)10-19(17)22(18(16)9-13)11-12-2-1-3-15(8-12)23(24)25/h1-10H,11H2 |
| InChIKey | YDLKGBFCYTZMJF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.13 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|