C13H10N4O3 — CID 83290800
1-[(3-nitrophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 83290800) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-[(3-nitrophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-[(3-nitrophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 83290800 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-[(3-nitrophenyl)methyl]-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2ncccc2n1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O3/c18-13-15-12-11(5-2-6-14-12)16(13)8-9-3-1-4-10(7-9)17(19)20/h1-7H,8H2,(H,14,15,18) |
| InChIKey | HPOAEBPREDWQST-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|