C14H10N4O5 — CID 141170730
(4-nitrophenyl) 2-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)acetate (PubChem CID 141170730) has the molecular formula C14H10N4O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is (4-nitrophenyl) 2-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)acetate.
| Compound Name | (4-nitrophenyl) 2-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 141170730 |
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (4-nitrophenyl) 2-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)acetate |
| SMILES | O=C(Cn1c(=O)[nH]c2ncccc21)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10N4O5/c19-12(23-10-5-3-9(4-6-10)18(21)22)8-17-11-2-1-7-15-13(11)16-14(17)20/h1-7H,8H2,(H,15,16,20) |
| InChIKey | ZWVFOGFHJYCKPY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|