C15H9ClN2O5S — CID 5210000
(4-nitrophenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate (PubChem CID 5210000) has the molecular formula C15H9ClN2O5S and a molecular weight of 364.77 g/mol. Its IUPAC name is (4-nitrophenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate.
| Compound Name | (4-nitrophenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 5210000 |
| Molecular Formula | C15H9ClN2O5S |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | (4-nitrophenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)sc2cccc(Cl)c21)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H9ClN2O5S/c16-11-2-1-3-12-14(11)17(15(20)24-12)8-13(19)23-10-6-4-9(5-7-10)18(21)22/h1-7H,8H2 |
| InChIKey | VKBANZXVGYIQGI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|