C14H19ClN2O4S — CID 167602014
2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 167602014) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 167602014 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C([O-])Cn1c(=O)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C9H6ClNO3S.C5H14NO/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6;1-6(2,3)4-5-7/h1-3H,4H2,(H,12,13);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | JWGRMQZUVSXJJT-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|