C9H6ClNO3S — CID 57256140
(4-chloro-2-oxo-1,3-benzothiazol-3-yl) acetate (PubChem CID 57256140) has the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. Its IUPAC name is (4-chloro-2-oxo-1,3-benzothiazol-3-yl) acetate.
| Compound Name | (4-chloro-2-oxo-1,3-benzothiazol-3-yl) acetate |
|---|---|
| PubChem CID | 57256140 |
| Molecular Formula | C9H6ClNO3S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | (4-chloro-2-oxo-1,3-benzothiazol-3-yl) acetate |
| SMILES | CC(=O)On1c(=O)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C9H6ClNO3S/c1-5(12)14-11-8-6(10)3-2-4-7(8)15-9(11)13/h2-4H,1H3 |
| InChIKey | XHJOVAWTXSYKKK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |