C16H10ClNO4S — CID 44721414
(2-formylphenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate (PubChem CID 44721414) has the molecular formula C16H10ClNO4S and a molecular weight of 347.78 g/mol. Its IUPAC name is (2-formylphenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate.
| Compound Name | (2-formylphenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 44721414 |
| Molecular Formula | C16H10ClNO4S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (2-formylphenyl) 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetate |
| SMILES | O=Cc1ccccc1OC(=O)Cn1c(=O)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C16H10ClNO4S/c17-11-5-3-7-13-15(11)18(16(21)23-13)8-14(20)22-12-6-2-1-4-10(12)9-19/h1-7,9H,8H2 |
| InChIKey | FQMOBMYNOIKZCJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|