About (2-formylphenyl) hept-6-enoate
(2-formylphenyl) hept-6-enoate (PubChem CID 87432029) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is (2-formylphenyl) hept-6-enoate.
Molecular Properties
| Compound Name | (2-formylphenyl) hept-6-enoate |
| PubChem CID | 87432029 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2-formylphenyl) hept-6-enoate |
| SMILES | C=CCCCCC(=O)Oc1ccccc1C=O |
| InChI | InChI=1S/C14H16O3/c1-2-3-4-5-10-14(16)17-13-9-7-6-8-12(13)11-15/h2,6-9,11H,1,3-5,10H2 |
| InChIKey | CMJKASCUIJLHCQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-formylphenyl) hept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formylphenyl) hept-6-enoate?
The IUPAC name of (2-formylphenyl) hept-6-enoate (CID 87432029) is (2-formylphenyl) hept-6-enoate.
What is the SMILES notation for (2-formylphenyl) hept-6-enoate?
The canonical SMILES for (2-formylphenyl) hept-6-enoate is C=CCCCCC(=O)Oc1ccccc1C=O.
What is the InChIKey of (2-formylphenyl) hept-6-enoate?
The InChIKey is CMJKASCUIJLHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c1-2-3-4-5-10-14(16)17-13-9-7-6-8-12(13)11-15/h2,6-9,11H,1,3-5,10H2.
What are the key properties of (2-formylphenyl) hept-6-enoate?
(2-formylphenyl) hept-6-enoate has a molecular weight of 232.28 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formylphenyl) hept-6-enoate is sourced from PubChem (CID 87432029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).