About dec-9-eneperoxoic acid
dec-9-eneperoxoic acid (PubChem CID 177164421) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is dec-9-eneperoxoic acid.
Molecular Properties
| Compound Name | dec-9-eneperoxoic acid |
| PubChem CID | 177164421 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | dec-9-eneperoxoic acid |
| SMILES | C=CCCCCCCCC(=O)OO |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-7-8-9-10(11)13-12/h2,12H,1,3-9H2 |
| InChIKey | ANHOWOKVFHMQQB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dec-9-eneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-9-eneperoxoic acid?
The IUPAC name of dec-9-eneperoxoic acid (CID 177164421) is dec-9-eneperoxoic acid.
What is the SMILES notation for dec-9-eneperoxoic acid?
The canonical SMILES for dec-9-eneperoxoic acid is C=CCCCCCCCC(=O)OO.
What is the InChIKey of dec-9-eneperoxoic acid?
The InChIKey is ANHOWOKVFHMQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-2-3-4-5-6-7-8-9-10(11)13-12/h2,12H,1,3-9H2.
What are the key properties of dec-9-eneperoxoic acid?
dec-9-eneperoxoic acid has a molecular weight of 186.25 g/mol, XLogP of 2.92, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dec-9-eneperoxoic acid is sourced from PubChem (CID 177164421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).