About sulfanyl undec-10-enoate
sulfanyl undec-10-enoate (PubChem CID 87067735) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is sulfanyl undec-10-enoate.
Molecular Properties
| Compound Name | sulfanyl undec-10-enoate |
| PubChem CID | 87067735 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | sulfanyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OS |
| InChI | InChI=1S/C11H20O2S/c1-2-3-4-5-6-7-8-9-10-11(12)13-14/h2,14H,1,3-10H2 |
| InChIKey | YUYZFJWROFQHFU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl undec-10-enoate?
The IUPAC name of sulfanyl undec-10-enoate (CID 87067735) is sulfanyl undec-10-enoate.
What is the SMILES notation for sulfanyl undec-10-enoate?
The canonical SMILES for sulfanyl undec-10-enoate is C=CCCCCCCCCC(=O)OS.
What is the InChIKey of sulfanyl undec-10-enoate?
The InChIKey is YUYZFJWROFQHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-2-3-4-5-6-7-8-9-10-11(12)13-14/h2,14H,1,3-10H2.
What are the key properties of sulfanyl undec-10-enoate?
sulfanyl undec-10-enoate has a molecular weight of 216.35 g/mol, XLogP of 3.68, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl undec-10-enoate is sourced from PubChem (CID 87067735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).