About (2-formylphenyl) but-3-enoate
(2-formylphenyl) but-3-enoate (PubChem CID 24823455) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is (2-formylphenyl) but-3-enoate.
Molecular Properties
| Compound Name | (2-formylphenyl) but-3-enoate |
| PubChem CID | 24823455 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2-formylphenyl) but-3-enoate |
| SMILES | C=CCC(=O)Oc1ccccc1C=O |
| InChI | InChI=1S/C11H10O3/c1-2-5-11(13)14-10-7-4-3-6-9(10)8-12/h2-4,6-8H,1,5H2 |
| InChIKey | ZZYQZCBJLLSUTC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-formylphenyl) but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formylphenyl) but-3-enoate?
The IUPAC name of (2-formylphenyl) but-3-enoate (CID 24823455) is (2-formylphenyl) but-3-enoate.
What is the SMILES notation for (2-formylphenyl) but-3-enoate?
The canonical SMILES for (2-formylphenyl) but-3-enoate is C=CCC(=O)Oc1ccccc1C=O.
What is the InChIKey of (2-formylphenyl) but-3-enoate?
The InChIKey is ZZYQZCBJLLSUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-2-5-11(13)14-10-7-4-3-6-9(10)8-12/h2-4,6-8H,1,5H2.
What are the key properties of (2-formylphenyl) but-3-enoate?
(2-formylphenyl) but-3-enoate has a molecular weight of 190.20 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formylphenyl) but-3-enoate is sourced from PubChem (CID 24823455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).