C20H15NO3S — CID 18823346
naphthalen-1-yl 3-(2-oxo-1,3-benzothiazol-3-yl)propanoate (PubChem CID 18823346) has the molecular formula C20H15NO3S and a molecular weight of 349.41 g/mol. Its IUPAC name is naphthalen-1-yl 3-(2-oxo-1,3-benzothiazol-3-yl)propanoate.
| Compound Name | naphthalen-1-yl 3-(2-oxo-1,3-benzothiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 18823346 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | naphthalen-1-yl 3-(2-oxo-1,3-benzothiazol-3-yl)propanoate |
| SMILES | O=C(CCn1c(=O)sc2ccccc21)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H15NO3S/c22-19(24-17-10-5-7-14-6-1-2-8-15(14)17)12-13-21-16-9-3-4-11-18(16)25-20(21)23/h1-11H,12-13H2 |
| InChIKey | HWNLUTRFGGKUFZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|