C20H14ClNO4 — CID 18208366
naphthalen-1-yl 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 18208366) has the molecular formula C20H14ClNO4 and a molecular weight of 367.79 g/mol. Its IUPAC name is naphthalen-1-yl 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | naphthalen-1-yl 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 18208366 |
| Molecular Formula | C20H14ClNO4 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | naphthalen-1-yl 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=C(CCn1c(=O)oc2cc(Cl)ccc21)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H14ClNO4/c21-14-8-9-16-18(12-14)26-20(24)22(16)11-10-19(23)25-17-7-3-5-13-4-1-2-6-15(13)17/h1-9,12H,10-11H2 |
| InChIKey | PXRJYFHSBBIJFO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|