C17H13NO5 — CID 18823370
(2-formylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 18823370) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is (2-formylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | (2-formylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 18823370 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (2-formylphenyl) 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=Cc1ccccc1OC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C17H13NO5/c19-11-12-5-1-3-7-14(12)22-16(20)9-10-18-13-6-2-4-8-15(13)23-17(18)21/h1-8,11H,9-10H2 |
| InChIKey | ZQESMOWEONNFMU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|